Difference between revisions of "D-Ribofuranose"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-581 RXN3O-581] == * direction: ** left-to-right * common-name: ** inositol phosphoceramide sy...")
(Created page with "Category:metabolite == Metabolite CPD-14873 == * common-name: ** 3-amino-4-hydroxybenzoate * smiles: ** c(=o)([o-])c1(c=c(n)c(o)=cc=1) * inchi-key: ** mrbkrzapgucwos-uhfff...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-581 RXN3O-581] ==
+
== Metabolite CPD-14873 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** inositol phosphoceramide synthase
+
** 3-amino-4-hydroxybenzoate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.1 ec-2.7.1]
+
** c(=o)([o-])c1(c=c(n)c(o)=cc=1)
−
* synonymous:
+
* inchi-key:
−
** phophatidylinositol ceramide phosphoinositol transferase
+
** mrbkrzapgucwos-uhfffaoysa-m
−
== Reaction formula ==
+
* molecular-weight:
−
* 1 [[Alpha-hydroxyphytoceramides]][c] '''+''' 1 [[L-1-phosphatidyl-inositols]][c] '''=>''' 1 [[DIACYLGLYCEROL]][c] '''+''' 1 [[IPC]][c]
+
** 152.129
−
== Gene(s) associated with this reaction  ==
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ17261]]
+
* [[RXN-15414]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) ==
+
{{#set: common-name=3-amino-4-hydroxybenzoate}}
−
* [[SPHINGOLIPID-SYN-PWY]], sphingolipid biosynthesis (yeast): [http://metacyc.org/META/NEW-IMAGE?object=SPHINGOLIPID-SYN-PWY SPHINGOLIPID-SYN-PWY]
+
{{#set: inchi-key=inchikey=mrbkrzapgucwos-uhfffaoysa-m}}
−
** '''4''' reactions found over '''11''' reactions in the full pathway
+
{{#set: molecular-weight=152.129}}
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=inositol phosphoceramide synthase}}
 
−
{{#set: ec-number=ec-2.7.1}}
 
−
{{#set: synonymous=phophatidylinositol ceramide phosphoinositol transferase}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-14873

  • common-name:
    • 3-amino-4-hydroxybenzoate
  • smiles:
    • c(=o)([o-])c1(c=c(n)c(o)=cc=1)
  • inchi-key:
    • mrbkrzapgucwos-uhfffaoysa-m
  • molecular-weight:
    • 152.129

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=D-Ribofuranose&oldid=47541"