Difference between revisions of "D-Ribofuranose"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14873 == * common-name: ** 3-amino-4-hydroxybenzoate * smiles: ** c(=o)([o-])c1(c=c(n)c(o)=cc=1) * inchi-key: ** mrbkrzapgucwos-uhfff...") |
(Created page with "Category:metabolite == Metabolite CPD-320 == * common-name: ** ethylnitronate * smiles: ** cc=n(=o)[o-] * inchi-key: ** yerbbvnyiklxdm-uhfffaoysa-n * molecular-weight: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-320 == |
* common-name: | * common-name: | ||
| − | ** | + | ** ethylnitronate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc=n(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yerbbvnyiklxdm-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 74.059 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[2-NITROPROPANE-DIOXYGENASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ethylnitronate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yerbbvnyiklxdm-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=74.059}} |
Revision as of 14:58, 5 January 2021
Contents
Metabolite CPD-320
- common-name:
- ethylnitronate
- smiles:
- cc=n(=o)[o-]
- inchi-key:
- yerbbvnyiklxdm-uhfffaoysa-n
- molecular-weight:
- 74.059
