Difference between revisions of "D-Ribofuranose"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Beta-D-glucosides == * common-name: ** a β-d glucoside == Reaction(s) known to consume the compound == * 3.2.1.21-RXN == Reactio...")
(Created page with "Category:metabolite == Metabolite CPD-11410 == * common-name: ** triiodothyroacetate ether glucuronide * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Beta-D-glucosides ==
+
== Metabolite CPD-11410 ==
 
* common-name:
 
* common-name:
** a β-d glucoside
+
** triiodothyroacetate ether glucuronide
 +
* smiles:
 +
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c=c3))
 +
* inchi-key:
 +
** vxvbzmwowmhxtq-kfyubchvsa-l
 +
* molecular-weight:
 +
** 796.046
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.2.1.21-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10619]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a β-d glucoside}}
+
{{#set: common-name=triiodothyroacetate ether glucuronide}}
 +
{{#set: inchi-key=inchikey=vxvbzmwowmhxtq-kfyubchvsa-l}}
 +
{{#set: molecular-weight=796.046}}

Revision as of 18:57, 14 January 2021

Metabolite CPD-11410

  • common-name:
    • triiodothyroacetate ether glucuronide
  • smiles:
    • c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c=c3))
  • inchi-key:
    • vxvbzmwowmhxtq-kfyubchvsa-l
  • molecular-weight:
    • 796.046

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality