Difference between revisions of "D-SEDOHEPTULOSE-1-7-P2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4207 == * common-name: ** isopentenyl adenosine * smiles: ** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23)) * inchi-key: ** usvm...")
(Created page with "Category:metabolite == Metabolite D-SEDOHEPTULOSE-1-7-P2 == * common-name: ** d-sedoheptulose-1,7-bisphosphate * smiles: ** c(op(=o)([o-])[o-])c(o)c(o)c(o)c(o)c(cop([o-])(...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-4207 ==
+
== Metabolite D-SEDOHEPTULOSE-1-7-P2 ==
 
* common-name:
 
* common-name:
−
** isopentenyl adenosine
+
** d-sedoheptulose-1,7-bisphosphate
 
* smiles:
 
* smiles:
−
** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23))
+
** c(op(=o)([o-])[o-])c(o)c(o)c(o)c(o)c(cop([o-])(=o)[o-])=o
 
* inchi-key:
 
* inchi-key:
−
** usvmjsalorzvdv-sdbhatresa-n
+
** okhxougreccasi-shuuezrqsa-j
 
* molecular-weight:
 
* molecular-weight:
−
** 335.362
+
** 366.112
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-4315]]
+
* [[SEDOBISALDOL-RXN]]
−
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
+
* [[SEDOHEPTULOSE-BISPHOSPHATASE-RXN]]
−
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-4315]]
+
* [[SEDOBISALDOL-RXN]]
−
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 
−
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=isopentenyl adenosine}}
+
{{#set: common-name=d-sedoheptulose-1,7-bisphosphate}}
−
{{#set: inchi-key=inchikey=usvmjsalorzvdv-sdbhatresa-n}}
+
{{#set: inchi-key=inchikey=okhxougreccasi-shuuezrqsa-j}}
−
{{#set: molecular-weight=335.362}}
+
{{#set: molecular-weight=366.112}}

Latest revision as of 11:16, 18 March 2021

Metabolite D-SEDOHEPTULOSE-1-7-P2

  • common-name:
    • d-sedoheptulose-1,7-bisphosphate
  • smiles:
    • c(op(=o)([o-])[o-])c(o)c(o)c(o)c(o)c(cop([o-])(=o)[o-])=o
  • inchi-key:
    • okhxougreccasi-shuuezrqsa-j
  • molecular-weight:
    • 366.112

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=D-SEDOHEPTULOSE-1-7-P2&oldid=139165"