Difference between revisions of "D-SEDOHEPTULOSE-1-7-P2"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9089 == * smiles: ** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=...") |
(Created page with "Category:metabolite == Metabolite D-SEDOHEPTULOSE-1-7-P2 == * common-name: ** d-sedoheptulose-1,7-bisphosphate * smiles: ** c(op(=o)([o-])[o-])c(o)c(o)c(o)c(o)c(cop([o-])(...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-SEDOHEPTULOSE-1-7-P2 == |
| + | * common-name: | ||
| + | ** d-sedoheptulose-1,7-bisphosphate | ||
* smiles: | * smiles: | ||
| − | ** | + | ** c(op(=o)([o-])[o-])c(o)c(o)c(o)c(o)c(cop([o-])(=o)[o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** okhxougreccasi-shuuezrqsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 366.112 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[SEDOBISALDOL-RXN]] |
| − | * [[RXN | + | * [[SEDOHEPTULOSE-BISPHOSPHATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[SEDOBISALDOL-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-sedoheptulose-1,7-bisphosphate}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=okhxougreccasi-shuuezrqsa-j}} |
| + | {{#set: molecular-weight=366.112}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite D-SEDOHEPTULOSE-1-7-P2
- common-name:
- d-sedoheptulose-1,7-bisphosphate
- smiles:
- c(op(=o)([o-])[o-])c(o)c(o)c(o)c(o)c(cop([o-])(=o)[o-])=o
- inchi-key:
- okhxougreccasi-shuuezrqsa-j
- molecular-weight:
- 366.112
