Difference between revisions of "D-SEDOHEPTULOSE-7-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-Acetyl-Peptides == * common-name: ** an n-acylated peptide == Reaction(s) known to consume the compound == * ACYLAMINOACYL-PEPTIDASE-...") |
(Created page with "Category:metabolite == Metabolite UDP-4-AMINO-4-DEOXY-L-ARABINOSE == * common-name: ** udp-4-amino-4-deoxy-β-l-arabinopyranose * smiles: ** c(op(=o)([o-])op(=o)([o-])...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite UDP-4-AMINO-4-DEOXY-L-ARABINOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** udp-4-amino-4-deoxy-β-l-arabinopyranose |
+ | * smiles: | ||
+ | ** c(op(=o)([o-])op(=o)([o-])oc1(occ([n+])c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)) | ||
+ | * inchi-key: | ||
+ | ** gwbakybswhqnmq-iazovdbxsa-m | ||
+ | * molecular-weight: | ||
+ | ** 534.286 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-1863]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN0-1863]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=udp-4-amino-4-deoxy-β-l-arabinopyranose}} |
+ | {{#set: inchi-key=inchikey=gwbakybswhqnmq-iazovdbxsa-m}} | ||
+ | {{#set: molecular-weight=534.286}} |
Revision as of 14:56, 5 January 2021
Contents
Metabolite UDP-4-AMINO-4-DEOXY-L-ARABINOSE
- common-name:
- udp-4-amino-4-deoxy-β-l-arabinopyranose
- smiles:
- c(op(=o)([o-])op(=o)([o-])oc1(occ([n+])c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3))
- inchi-key:
- gwbakybswhqnmq-iazovdbxsa-m
- molecular-weight:
- 534.286