Difference between revisions of "D-TRYPTOPHAN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite R-3-hydroxylignoceroyl-ACPs == * common-name: ** a (3r)-3-hydroxylignoceroyl-[acp] == Reaction(s) known to consume the compound == * RX...") |
(Created page with "Category:metabolite == Metabolite D-TRYPTOPHAN == * common-name: ** d-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) * inchi-key: ** qivbcdijiajpqs-secbi...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-TRYPTOPHAN == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-tryptophan |
| + | * smiles: | ||
| + | ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) | ||
| + | * inchi-key: | ||
| + | ** qivbcdijiajpqs-secbinfhsa-n | ||
| + | * molecular-weight: | ||
| + | ** 204.228 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-8664]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-tryptophan}} |
| + | {{#set: inchi-key=inchikey=qivbcdijiajpqs-secbinfhsa-n}} | ||
| + | {{#set: molecular-weight=204.228}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite D-TRYPTOPHAN
- common-name:
- d-tryptophan
- smiles:
- c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
- inchi-key:
- qivbcdijiajpqs-secbinfhsa-n
- molecular-weight:
- 204.228
