Difference between revisions of "D-TRYPTOPHAN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17731 RXN-17731] == * direction: ** left-to-right * common-name: ** 2-acyl-1-alkyl-sn-glycerol...")
 
(Created page with "Category:metabolite == Metabolite D-TRYPTOPHAN == * common-name: ** d-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) * inchi-key: ** qivbcdijiajpqs-secbi...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17731 RXN-17731] ==
+
== Metabolite D-TRYPTOPHAN ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 2-acyl-1-alkyl-sn-glycerol ethanolaminephosphotransferase
+
** d-tryptophan
−
** ethanolaminephosphotransferase
+
* smiles:
−
* ec-number:
+
** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
−
** [http://enzyme.expasy.org/EC/2.7.8.1 ec-2.7.8.1]
+
* inchi-key:
−
== Reaction formula ==
+
** qivbcdijiajpqs-secbinfhsa-n
−
* 1 [[1-Alkyl-2-acyl-glycerol]][c] '''+''' 1 [[CDP-ETHANOLAMINE]][c] '''=>''' 1 [[1-Alkyl-2-acyl-glycerol-P-Etn]][c] '''+''' 1 [[CMP]][c] '''+''' 1 [[PROTON]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 204.228
−
* Gene: [[SJ19317]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN-8664]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ16464]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=d-tryptophan}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: inchi-key=inchikey=qivbcdijiajpqs-secbinfhsa-n}}
−
== Pathway(s) ==
+
{{#set: molecular-weight=204.228}}
−
* [[PWY-7782]], plasmalogen biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7782 PWY-7782]
 
−
** '''11''' reactions found over '''16''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=2-acyl-1-alkyl-sn-glycerol ethanolaminephosphotransferase|ethanolaminephosphotransferase}}
 
−
{{#set: ec-number=ec-2.7.8.1}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite D-TRYPTOPHAN

  • common-name:
    • d-tryptophan
  • smiles:
    • c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
  • inchi-key:
    • qivbcdijiajpqs-secbinfhsa-n
  • molecular-weight:
    • 204.228

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=D-TRYPTOPHAN&oldid=139336"