Difference between revisions of "D-TRYPTOPHAN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10954 RXN-10954] == * direction: ** left-to-right * common-name: ** myo-inositol-6-phosphate mo...")
(Created page with "Category:metabolite == Metabolite D-TRYPTOPHAN == * common-name: ** d-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) * inchi-key: ** qivbcdijiajpqs-secbi...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10954 RXN-10954] ==
+
== Metabolite D-TRYPTOPHAN ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** myo-inositol-6-phosphate monophosphatase
+
** d-tryptophan
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.1.3.25 ec-3.1.3.25]
+
** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-6702]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[MYO-INOSITOL]][c] '''+''' 1 [[Pi]][c]
+
** qivbcdijiajpqs-secbinfhsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 204.228
−
* Gene: [[SJ20976]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN-8664]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ18979]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=d-tryptophan}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=qivbcdijiajpqs-secbinfhsa-n}}
−
* Gene: [[SJ15444]]
+
{{#set: molecular-weight=204.228}}
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ04955]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ10706]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ01133]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=44161 44161]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=myo-inositol-6-phosphate monophosphatase}}
 
−
{{#set: ec-number=ec-3.1.3.25}}
 
−
{{#set: nb gene associated=6}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite D-TRYPTOPHAN

  • common-name:
    • d-tryptophan
  • smiles:
    • c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
  • inchi-key:
    • qivbcdijiajpqs-secbinfhsa-n
  • molecular-weight:
    • 204.228

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=D-TRYPTOPHAN&oldid=139336"