Difference between revisions of "D-Xylopyranose"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite mRNAs == * common-name: ** an mrna == Reaction(s) known to consume the compound == * POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN == Reacti...")
(Created page with "Category:metabolite == Metabolite CPD-9898 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite mRNAs ==
+
== Metabolite CPD-9898 ==
 
* common-name:
 
* common-name:
** an mrna
+
** 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate
 +
* smiles:
 +
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
 +
* inchi-key:
 +
** fdppbyxdoxrdha-jsgwljpksa-m
 +
* molecular-weight:
 +
** 780.205
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.13.4-RXN]]
+
* [[RXN-9281]]
* [[POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an mrna}}
+
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate}}
 +
{{#set: inchi-key=inchikey=fdppbyxdoxrdha-jsgwljpksa-m}}
 +
{{#set: molecular-weight=780.205}}

Revision as of 15:26, 5 January 2021

Metabolite CPD-9898

  • common-name:
    • 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
  • inchi-key:
    • fdppbyxdoxrdha-jsgwljpksa-m
  • molecular-weight:
    • 780.205

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality