Difference between revisions of "D-galactopyranose"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LINAMARIN == * common-name: ** linamarin * smiles: ** cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1) * inchi-key: ** qltchmyaejexbt-zebdfxrssa-n * mo...")
(Created page with "Category:metabolite == Metabolite D-galactopyranose == * common-name: ** d-galactopyranose == Reaction(s) known to consume the compound == * RXN-12078 * TRANS-RXN-21...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LINAMARIN ==
+
== Metabolite D-galactopyranose ==
 
* common-name:
 
* common-name:
** linamarin
+
** d-galactopyranose
* smiles:
 
** cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1)
 
* inchi-key:
 
** qltchmyaejexbt-zebdfxrssa-n
 
* molecular-weight:
 
** 247.247
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-5341]]
+
* [[RXN-12078]]
 +
* [[TRANS-RXN-21]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13602]]
+
* [[3.2.1.23-RXN]]
 +
* [[ALPHAGALACTOSID-RXN]]
 +
* [[RXN-12078]]
 +
* [[RXN-12398]]
 +
* [[RXN-12399]]
 +
* [[RXN-12400]]
 +
* [[RXN-17830]]
 +
* [[TRANS-RXN-21]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=linamarin}}
+
{{#set: common-name=d-galactopyranose}}
{{#set: inchi-key=inchikey=qltchmyaejexbt-zebdfxrssa-n}}
 
{{#set: molecular-weight=247.247}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite D-galactopyranose

  • common-name:
    • d-galactopyranose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality