Difference between revisions of "D-galactopyranose"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10377 == * transcription-direction: ** negative * right-end-position: ** 726933 * left-end-position: ** 709554 * centisome-position: ** 87.70407...")
(Created page with "Category:metabolite == Metabolite LINAMARIN == * common-name: ** linamarin * smiles: ** cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1) * inchi-key: ** qltchmyaejexbt-zebdfxrssa-n * mo...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ10377 ==
+
== Metabolite LINAMARIN ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** linamarin
−
* right-end-position:
+
* smiles:
−
** 726933
+
** cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1)
−
* left-end-position:
+
* inchi-key:
−
** 709554
+
** qltchmyaejexbt-zebdfxrssa-n
−
* centisome-position:
+
* molecular-weight:
−
** 87.70407   
+
** 247.247
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-5341]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[ARGSUCCINSYN-RXN]]
+
* [[RXN-13602]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=linamarin}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=qltchmyaejexbt-zebdfxrssa-n}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=247.247}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-10]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7400]]
 
−
** '''7''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-4984]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[ARGSYN-PWY]]
 
−
** '''5''' reactions found over '''4''' reactions in the full pathway
 
−
* [[ARGSYNBSUB-PWY]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-4983]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-5154]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-5]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=726933}}
 
−
{{#set: left-end-position=709554}}
 
−
{{#set: centisome-position=87.70407    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=7}}
 

Revision as of 20:29, 18 December 2020

Metabolite LINAMARIN

  • common-name:
    • linamarin
  • smiles:
    • cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1)
  • inchi-key:
    • qltchmyaejexbt-zebdfxrssa-n
  • molecular-weight:
    • 247.247

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=D-galactopyranose&oldid=45441"