Difference between revisions of "D-galactopyranose"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LINAMARIN == * common-name: ** linamarin * smiles: ** cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1) * inchi-key: ** qltchmyaejexbt-zebdfxrssa-n * mo...") |
(Created page with "Category:metabolite == Metabolite Thiols == * common-name: ** a thiol == Reaction(s) known to consume the compound == * THIOL-S-METHYLTRANSFERASE-RXN == Reaction(s) kn...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Thiols == |
* common-name: | * common-name: | ||
| − | ** | + | ** a thiol |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[THIOL-S-METHYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15582]] |
| + | * [[RXN-6763]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a thiol}} |
| − | |||
| − | |||
Revision as of 14:53, 5 January 2021
Contents
Metabolite Thiols
- common-name:
- a thiol
