Difference between revisions of "D-glucopyranose-6-phosphate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.2.1.25-RXN 1.2.1.25-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.o...")
(Created page with "Category:metabolite == Metabolite ALPHA-TOCOPHEROL == * common-name: ** α-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=c(c)c(=c(o1)2)c)c)) * inch...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.2.1.25-RXN 1.2.1.25-RXN] ==
+
== Metabolite ALPHA-TOCOPHEROL ==
* direction:
+
* common-name:
** left-to-right
+
** α-tocopherol
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.2.1.25 ec-1.2.1.25]
+
** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=c(c)c(=c(o1)2)c)c))
== Reaction formula ==
+
* inchi-key:
* 1 [[2-KETO-ISOVALERATE]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[ISOBUTYRYL-COA]][c] '''+''' 1 [[NADH]][c]
+
** gvjhhuawpyxkbd-ieosbipesa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ11017]]
+
** 430.713
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
== Pathway(s) ==
+
* [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
* [[VALDEG-PWY]], L-valine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=VALDEG-PWY VALDEG-PWY]
+
== Reaction(s) of unknown directionality ==
** '''6''' reactions found over '''8''' reactions in the full pathway
+
{{#set: common-name=α-tocopherol}}
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=gvjhhuawpyxkbd-ieosbipesa-n}}
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=430.713}}
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13998 13998]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R01210 R01210]
 
{{#set: direction=left-to-right}}
 
{{#set: ec-number=ec-1.2.1.25}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Revision as of 20:36, 18 December 2020

Metabolite ALPHA-TOCOPHEROL

  • common-name:
    • α-tocopherol
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=c(c)c(=c(o1)2)c)c))
  • inchi-key:
    • gvjhhuawpyxkbd-ieosbipesa-n
  • molecular-weight:
    • 430.713

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality