Difference between revisions of "D-glucopyranose-6-phosphate"

Latest revision as of 11:16, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-15152 ==
+== Metabolite D-glucopyranose-6-phosphate ==
 * common-name:
-** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone
+** d-glucopyranose 6-phosphate
-* smiles:
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c=1)
-* inchi-key:
-** aftbilpwmusgin-mycgwmctsa-n
-* molecular-weight:
-** 683.068
 == Reaction(s) known to consume the compound ==
-* [[RXN-14177]]
+* [[GLU6PDEHYDROG-RXN]]
+* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
+* [[PGLUCISOM-RXN]]
+* [[PHOSPHOGLUCMUT-RXN]]
+* [[RXN-14819]]
+* [[RXN66-526]]
+* [[TREHALOSE6PSYN-RXN]]
 == Reaction(s) known to produce the compound ==
+* [[GLUCOKIN-RXN]]
+* [[PGLUCISOM-RXN]]
+* [[PHOSPHOGLUCMUT-RXN]]
+* [[RXN-14819]]
+* [[RXN-16998]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone}}
+{{#set: common-name=d-glucopyranose 6-phosphate}}
-{{#set: inchi-key=inchikey=aftbilpwmusgin-mycgwmctsa-n}}
-{{#set: molecular-weight=683.068}}