Difference between revisions of "D-mannopyranose"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UMP == * common-name: ** ump * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** djjcxfvjdgthfx-xvfcmesi...")
(Created page with "Category:metabolite == Metabolite D-mannopyranose == * common-name: ** d-mannopyranose == Reaction(s) known to consume the compound == * MANNKIN-RXN * MANNKIN-RXN-D-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UMP ==
+
== Metabolite D-mannopyranose ==
 
* common-name:
 
* common-name:
** ump
+
** d-mannopyranose
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
 
* inchi-key:
 
** djjcxfvjdgthfx-xvfcmesisa-l
 
* molecular-weight:
 
** 322.168
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12002]]
+
* [[MANNKIN-RXN]]
* [[RXN-14025]]
+
* [[MANNKIN-RXN-D-mannopyranose/ATP//MANNOSE-6P/ADP/PROTON.43.]]
* [[RXN-8975]]
 
* [[UDPGALth]]
 
* [[UMPP]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-13064]]
* [[2.7.8.15-RXN]]
 
* [[2.7.8.17-RXN]]
 
* [[AUPT]]
 
* [[DATUP]]
 
* [[DCTUP]]
 
* [[DGTUP]]
 
* [[DTTUP]]
 
* [[DUTUP]]
 
* [[GTUP]]
 
* [[ITUP]]
 
* [[OROTPDECARB-RXN]]
 
* [[ORPDC]]
 
* [[PHOSNACMURPENTATRANS-RXN]]
 
* [[RXN-11347]]
 
* [[RXN-12197]]
 
* [[RXN-12199]]
 
* [[RXN-14139]]
 
* [[RXN-8975]]
 
* [[UDPGALth]]
 
* [[URACIL-PRIBOSYLTRANS-RXN]]
 
* [[URIDINEKIN-RXN]]
 
* [[URKI-RXN]]
 
* [[UTPPH]]
 
* [[UTUP]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ump}}
+
{{#set: common-name=d-mannopyranose}}
{{#set: inchi-key=inchikey=djjcxfvjdgthfx-xvfcmesisa-l}}
 
{{#set: molecular-weight=322.168}}
 

Revision as of 18:59, 14 January 2021

Metabolite D-mannopyranose

  • common-name:
    • d-mannopyranose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality