Difference between revisions of "D-mannopyranose"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite XYLULOSE-5-PHOSPHATE == * common-name: ** d-xylulose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)c(o)c(=o)co * inchi-key: ** fnzlkvnu...") |
(Created page with "Category:metabolite == Metabolite D-mannopyranose == * common-name: ** d-mannopyranose == Reaction(s) known to consume the compound == * MANNKIN-RXN * MANNKIN-RXN-D-...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-mannopyranose == |
* common-name: | * common-name: | ||
| − | ** d- | + | ** d-mannopyranose |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[MANNKIN-RXN]] |
| − | * [[ | + | * [[MANNKIN-RXN-D-mannopyranose/ATP//MANNOSE-6P/ADP/PROTON.43.]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13064]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=d- | + | {{#set: common-name=d-mannopyranose}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite D-mannopyranose
- common-name:
- d-mannopyranose
