|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=H2PTERIDINEPYROPHOSPHOKIN-RXN H2PTERIDINEPYROPHOSPHOKIN-RXN] == | + | == Metabolite CPD-9924 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** 6-hydroxymethyl-7,8-dihydropterin pyrophosphokinase | + | ** 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate |
| − | * ec-number:
| + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.7.6.3 ec-2.7.6.3]
| + | ** c=c(c(=o)[o-])oc1(cc=c(c(=o)ccc(=o)[o-])c(c(o)1)c(=o)[o-]) |
| − | == Reaction formula ==
| + | * inchi-key: |
| − | * 1 [[AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[DIHYDROPTERIN-CH2OH-PP]][c] '''+''' 1 [[PROTON]][c]
| + | ** jkjglrglomrxfn-mvwjerbfsa-k |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ22398]]
| + | ** 325.251 |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[orthology]] | + | * [[2.5.1.64-RXN]] |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate}} |
| − | == Pathway(s) == | + | {{#set: inchi-key=inchikey=jkjglrglomrxfn-mvwjerbfsa-k}} |
| − | * [[PWY-6797]], 6-hydroxymethyl-dihydropterin diphosphate biosynthesis II (Methanocaldococcus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6797 PWY-6797]
| + | {{#set: molecular-weight=325.251}} |
| − | ** '''3''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7853]], 6-hydroxymethyl-dihydropterin diphosphate biosynthesis V (Pyrococcus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7853 PWY-7853]
| |
| − | ** '''1''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7852]], 6-hydroxymethyl-dihydropterin diphosphate biosynthesis IV (Plasmodium): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7852 PWY-7852]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway | |
| − | * [[PWY-7539]], 6-hydroxymethyl-dihydropterin diphosphate biosynthesis III (Chlamydia): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7539 PWY-7539]
| |
| − | ** '''4''' reactions found over '''5''' reactions in the full pathway | |
| − | * [[PWY-6147]], 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6147 PWY-6147] | |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway | |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA: | |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11413 11413]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R03503 R03503]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P22291 P22291]
| |
| − | ** [http://www.uniprot.org/uniprot/P26281 P26281]
| |
| − | ** [http://www.uniprot.org/uniprot/O84619 O84619]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZM35 Q9ZM35]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9RXY4 Q9RXY4]
| |
| − | ** [http://www.uniprot.org/uniprot/O66550 O66550]
| |
| − | ** [http://www.uniprot.org/uniprot/O25680 O25680]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PJ54 Q9PJ54]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JV81 Q9JV81]
| |
| − | ** [http://www.uniprot.org/uniprot/P64143 P64143]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9Z7E8 Q9Z7E8]
| |
| − | ** [http://www.uniprot.org/uniprot/P82602 P82602]
| |
| − | ** [http://www.uniprot.org/uniprot/P29252 P29252]
| |
| − | ** [http://www.uniprot.org/uniprot/P72736 P72736]
| |
| − | ** [http://www.uniprot.org/uniprot/O04862 O04862]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9SZV3 Q9SZV3]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9X8I1 Q9X8I1]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=6-hydroxymethyl-7,8-dihydropterin pyrophosphokinase}} | |
| − | {{#set: ec-number=ec-2.7.6.3}}
| |
| − | {{#set: nb gene associated=1}}
| |
| − | {{#set: nb pathway associated=5}} | |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_arabidopsis_thaliana}}
| |
