Difference between revisions of "DADP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2030 == * common-name: ** glycerophosphoserine * smiles: ** c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o * inchi-key: ** zwzwygmenqvnfu-u...")
(Created page with "Category:metabolite == Metabolite Amino-Acids == * common-name: ** an amino acid == Reaction(s) known to consume the compound == * GAMMA-GLUTAMYLTRANSFERASE-RXN == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2030 ==
+
== Metabolite Amino-Acids ==
 
* common-name:
 
* common-name:
** glycerophosphoserine
+
** an amino acid
* smiles:
 
** c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o
 
* inchi-key:
 
** zwzwygmenqvnfu-uhnvwzdzsa-m
 
* molecular-weight:
 
** 258.144
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14136]]
+
* [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glycerophosphoserine}}
+
{{#set: common-name=an amino acid}}
{{#set: inchi-key=inchikey=zwzwygmenqvnfu-uhnvwzdzsa-m}}
 
{{#set: molecular-weight=258.144}}
 

Revision as of 11:15, 15 January 2021

Metabolite Amino-Acids

  • common-name:
    • an amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality