Difference between revisions of "DADP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2030 == * common-name: ** glycerophosphoserine * smiles: ** c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o * inchi-key: ** zwzwygmenqvnfu-u...") |
(Created page with "Category:metabolite == Metabolite Amino-Acids == * common-name: ** an amino acid == Reaction(s) known to consume the compound == * GAMMA-GLUTAMYLTRANSFERASE-RXN == Rea...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Amino-Acids == |
* common-name: | * common-name: | ||
− | ** | + | ** an amino acid |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[GAMMA-GLUTAMYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an amino acid}} |
− | |||
− |
Revision as of 11:15, 15 January 2021
Contents
Metabolite Amino-Acids
- common-name:
- an amino acid