Difference between revisions of "DADP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00979 == * transcription-direction: ** positive * right-end-position: ** 62599 * left-end-position: ** 57292 * centisome-position: ** 36.04948...") |
(Created page with "Category:metabolite == Metabolite DADP == * common-name: ** dadp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o * inchi-key: ** daeap...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DADP == |
| − | * | + | * common-name: |
| − | ** | + | ** dadp |
| − | * | + | * smiles: |
| − | ** | + | ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** daeapnuqqaicnr-rrkcrqdmsa-k |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 408.18 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[DADPKIN-RXN]] |
| − | == Reaction(s) | + | * [[DATPtm]] |
| − | * [[ | + | * [[NDPK]] |
| − | * | + | * [[NDPKm]] |
| − | * | + | * [[RXN-14192]] |
| − | * | + | * [[RXN-14215]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[ADPREDUCT-RXN]] |
| − | * | + | * [[ATDAM]] |
| − | == | + | * [[DAOTO]] |
| − | + | * [[DATCY]] | |
| − | + | * [[DATPtm]] | |
| − | {{#set: | + | * [[DATUP]] |
| − | {{#set: | + | * [[DEOXYADENYLATE-KINASE-RXN]] |
| − | + | * [[RXN-14214]] | |
| − | {{#set: | + | * [[RXN0-747]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=dadp}} | |
| − | + | {{#set: inchi-key=inchikey=daeapnuqqaicnr-rrkcrqdmsa-k}} | |
| + | {{#set: molecular-weight=408.18}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite DADP
- common-name:
- dadp
- smiles:
- c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o
- inchi-key:
- daeapnuqqaicnr-rrkcrqdmsa-k
- molecular-weight:
- 408.18
