Difference between revisions of "DADP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06109 == * transcription-direction: ** negative * right-end-position: ** 293214 * left-end-position: ** 290043 * centisome-position: ** 60.267673...")
(Created page with "Category:metabolite == Metabolite DADP == * common-name: ** dadp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o * inchi-key: ** daeap...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ06109 ==
+
== Metabolite DADP ==
* transcription-direction:
+
* common-name:
** negative
+
** dadp
* right-end-position:
+
* smiles:
** 293214
+
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o
* left-end-position:
+
* inchi-key:
** 290043
+
** daeapnuqqaicnr-rrkcrqdmsa-k
* centisome-position:
+
* molecular-weight:
** 60.267673   
+
** 408.18
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[DADPKIN-RXN]]
== Reaction(s) associated ==
+
* [[DATPtm]]
* [[ATPASE-RXN]]
+
* [[NDPK]]
** Category: [[annotation]]
+
* [[NDPKm]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14192]]
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[RXN-14215]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ADPREDUCT-RXN]]
* [[RXN-12195]]
+
* [[ATDAM]]
** Category: [[annotation]]
+
* [[DAOTO]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DATCY]]
* [[RXN-12196]]
+
* [[DATPtm]]
** Category: [[annotation]]
+
* [[DATUP]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DEOXYADENYLATE-KINASE-RXN]]
* [[RXN0-5462]]
+
* [[RXN-14214]]
** Category: [[annotation]]
+
* [[RXN0-747]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) associated ==
+
{{#set: common-name=dadp}}
* [[PWY-7210]]
+
{{#set: inchi-key=inchikey=daeapnuqqaicnr-rrkcrqdmsa-k}}
** '''8''' reactions found over '''8''' reactions in the full pathway
+
{{#set: molecular-weight=408.18}}
* [[PWY-7198]]
 
** '''6''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-7184]]
 
** '''9''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-6545]]
 
** '''8''' reactions found over '''9''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=293214}}
 
{{#set: left-end-position=290043}}
 
{{#set: centisome-position=60.267673    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=5}}
 
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite DADP

  • common-name:
    • dadp
  • smiles:
    • c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o
  • inchi-key:
    • daeapnuqqaicnr-rrkcrqdmsa-k
  • molecular-weight:
    • 408.18

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality