Difference between revisions of "DADP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02152 == * transcription-direction: ** positive * right-end-position: ** 41053 * left-end-position: ** 35728 * centisome-position: ** 25.445301...") |
(Created page with "Category:metabolite == Metabolite DADP == * common-name: ** dadp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o * inchi-key: ** daeap...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DADP == |
− | * | + | * common-name: |
− | ** | + | ** dadp |
− | * | + | * smiles: |
− | ** | + | ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o |
− | * | + | * inchi-key: |
− | ** | + | ** daeapnuqqaicnr-rrkcrqdmsa-k |
− | * | + | * molecular-weight: |
− | ** | + | ** 408.18 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[DADPKIN-RXN]] | |
− | == Reaction(s) | + | * [[DATPtm]] |
− | * [[ | + | * [[NDPK]] |
− | * | + | * [[NDPKm]] |
− | * | + | * [[RXN-14192]] |
− | * [[ | + | * [[RXN-14215]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[ADPREDUCT-RXN]] |
− | * [[ | + | * [[ATDAM]] |
− | * | + | * [[DAOTO]] |
− | * | + | * [[DATCY]] |
− | * [[RXN | + | * [[DATPtm]] |
− | * | + | * [[DATUP]] |
− | * | + | * [[DEOXYADENYLATE-KINASE-RXN]] |
− | {{#set: | + | * [[RXN-14214]] |
− | {{#set: | + | * [[RXN0-747]] |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=dadp}} |
− | + | {{#set: inchi-key=inchikey=daeapnuqqaicnr-rrkcrqdmsa-k}} | |
− | + | {{#set: molecular-weight=408.18}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite DADP
- common-name:
- dadp
- smiles:
- c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o
- inchi-key:
- daeapnuqqaicnr-rrkcrqdmsa-k
- molecular-weight:
- 408.18