Difference between revisions of "DADP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12253 == * common-name: ** (r)-2-hydroxybutanoate * smiles: ** ccc(o)c(=o)[o-] * inchi-key: ** afendnxgafykqo-gsvougtgsa-m * molecula...") |
(Created page with "Category:metabolite == Metabolite CPD-15838 == * common-name: ** γ-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c * inchi-key: *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-15838 == |
* common-name: | * common-name: | ||
| − | ** | + | ** γ-tocotrienol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** otxntmvvoobzcv-wazjvijmsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 410.639 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14918]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=γ-tocotrienol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=otxntmvvoobzcv-wazjvijmsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=410.639}} |
Revision as of 14:56, 5 January 2021
Contents
Metabolite CPD-15838
- common-name:
- γ-tocotrienol
- smiles:
- cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c
- inchi-key:
- otxntmvvoobzcv-wazjvijmsa-n
- molecular-weight:
- 410.639
