Difference between revisions of "DADP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15838 == * common-name: ** γ-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite O-D-MANNOSYL-PROTEIN == * common-name: ** a 3-o-(α-d-mannosyl)-(ser/thr)-[protein] == Reaction(s) known to consume the compound ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite O-D-MANNOSYL-PROTEIN == |
* common-name: | * common-name: | ||
| − | ** & | + | ** a 3-o-(α-d-mannosyl)-(ser/thr)-[protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.4.1.109-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=& | + | {{#set: common-name=a 3-o-(α-d-mannosyl)-(ser/thr)-[protein]}} |
| − | |||
| − | |||
Revision as of 15:27, 5 January 2021
Contents
Metabolite O-D-MANNOSYL-PROTEIN
- common-name:
- a 3-o-(α-d-mannosyl)-(ser/thr)-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 3-o-(α-d-mannosyl)-(ser/thr)-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
