Difference between revisions of "DAMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5242 RXN-5242] == * direction: ** left-to-right * common-name: ** ent-kaurenol 19-dehydrogenase...")
(Created page with "Category:metabolite == Metabolite DAMP == * common-name: ** damp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o * inchi-key: ** khwchtkseggwex-rr...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5242 RXN-5242] ==
+
== Metabolite DAMP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** ent-kaurenol 19-dehydrogenase
+
** damp
−
== Reaction formula ==
+
* smiles:
−
* 1 [[ENT-KAUR-16-EN-19-OL]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[ENT-KAUR-16-EN-19-AL]][c] '''+''' 1 [[NADP]][c] '''+''' 2 [[WATER]][c]
+
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ11349]]
+
** khwchtkseggwex-rrkcrqdmsa-l
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 329.208
−
* Gene: [[SJ11348]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[orthology]]
+
* [[ATDAM]]
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[DAMPH]]
−
* Gene: [[SJ09087]]
+
* [[DEOXYADENYLATE-KINASE-RXN]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[DAMPH]]
−
* Gene: [[SJ11355]]
+
* [[RXN-14195]]
−
** Category: [[orthology]]
+
* [[RXN-14215]]
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN0-384]]
−
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-5034]], GA12 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5034 PWY-5034]
+
{{#set: common-name=damp}}
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=khwchtkseggwex-rrkcrqdmsa-l}}
−
* [[PWY-5047]], gibberellin biosynthesis IV (Gibberella fujikuroi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5047 PWY-5047]
+
{{#set: molecular-weight=329.208}}
−
** '''6''' reactions found over '''15''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21305 21305]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R06292 R06292]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=ent-kaurenol 19-dehydrogenase}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_arabidopsis_thaliana}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite DAMP

  • common-name:
    • damp
  • smiles:
    • c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o
  • inchi-key:
    • khwchtkseggwex-rrkcrqdmsa-l
  • molecular-weight:
    • 329.208

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DAMP&oldid=138894"