Difference between revisions of "DAMP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Leader-Sequences == * common-name: ** a leader sequence == Reaction(s) known to consume the compound == == Reaction(s) known to produce t...") |
(Created page with "Category:metabolite == Metabolite DAMP == * common-name: ** damp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o * inchi-key: ** khwchtkseggwex-rr...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DAMP == |
* common-name: | * common-name: | ||
− | ** | + | ** damp |
+ | * smiles: | ||
+ | ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o | ||
+ | * inchi-key: | ||
+ | ** khwchtkseggwex-rrkcrqdmsa-l | ||
+ | * molecular-weight: | ||
+ | ** 329.208 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ATDAM]] | ||
+ | * [[DAMPH]] | ||
+ | * [[DEOXYADENYLATE-KINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[DAMPH]] |
+ | * [[RXN-14195]] | ||
+ | * [[RXN-14215]] | ||
+ | * [[RXN0-384]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=damp}} |
+ | {{#set: inchi-key=inchikey=khwchtkseggwex-rrkcrqdmsa-l}} | ||
+ | {{#set: molecular-weight=329.208}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite DAMP
- common-name:
- damp
- smiles:
- c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o
- inchi-key:
- khwchtkseggwex-rrkcrqdmsa-l
- molecular-weight:
- 329.208