Difference between revisions of "DAMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Leader-Sequences == * common-name: ** a leader sequence == Reaction(s) known to consume the compound == == Reaction(s) known to produce t...")
(Created page with "Category:metabolite == Metabolite DAMP == * common-name: ** damp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o * inchi-key: ** khwchtkseggwex-rr...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Leader-Sequences ==
+
== Metabolite DAMP ==
 
* common-name:
 
* common-name:
** a leader sequence
+
** damp
 +
* smiles:
 +
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o
 +
* inchi-key:
 +
** khwchtkseggwex-rrkcrqdmsa-l
 +
* molecular-weight:
 +
** 329.208
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ATDAM]]
 +
* [[DAMPH]]
 +
* [[DEOXYADENYLATE-KINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.4.21.89-RXN]]
+
* [[DAMPH]]
 +
* [[RXN-14195]]
 +
* [[RXN-14215]]
 +
* [[RXN0-384]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a leader sequence}}
+
{{#set: common-name=damp}}
 +
{{#set: inchi-key=inchikey=khwchtkseggwex-rrkcrqdmsa-l}}
 +
{{#set: molecular-weight=329.208}}

Latest revision as of 11:16, 18 March 2021

Metabolite DAMP

  • common-name:
    • damp
  • smiles:
    • c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o
  • inchi-key:
    • khwchtkseggwex-rrkcrqdmsa-l
  • molecular-weight:
    • 329.208

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality