Difference between revisions of "DAMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-698 == * common-name: ** campest-4-en-3-one * smiles: ** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34)))) * in...")
(Created page with "Category:metabolite == Metabolite DAMP == * common-name: ** damp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o * inchi-key: ** khwchtkseggwex-rr...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-698 ==
+
== Metabolite DAMP ==
 
* common-name:
 
* common-name:
** campest-4-en-3-one
+
** damp
 
* smiles:
 
* smiles:
** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
+
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o
 
* inchi-key:
 
* inchi-key:
** qqiopzfvtihasb-imudckkosa-n
+
** khwchtkseggwex-rrkcrqdmsa-l
 
* molecular-weight:
 
* molecular-weight:
** 398.671
+
** 329.208
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4231]]
+
* [[ATDAM]]
* [[RXN-711]]
+
* [[DAMPH]]
 +
* [[DEOXYADENYLATE-KINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DAMPH]]
 +
* [[RXN-14195]]
 +
* [[RXN-14215]]
 +
* [[RXN0-384]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=campest-4-en-3-one}}
+
{{#set: common-name=damp}}
{{#set: inchi-key=inchikey=qqiopzfvtihasb-imudckkosa-n}}
+
{{#set: inchi-key=inchikey=khwchtkseggwex-rrkcrqdmsa-l}}
{{#set: molecular-weight=398.671}}
+
{{#set: molecular-weight=329.208}}

Latest revision as of 11:16, 18 March 2021

Metabolite DAMP

  • common-name:
    • damp
  • smiles:
    • c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o
  • inchi-key:
    • khwchtkseggwex-rrkcrqdmsa-l
  • molecular-weight:
    • 329.208

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality