Difference between revisions of "DATP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PYRIDOXAL_PHOSPHATE == * common-name: ** pyridoxal 5'-phosphate * smiles: ** cc1(n=cc(=c(c=1o)c=o)cop(=o)([o-])[o-]) * inchi-key: ** ngvd...") |
(Created page with "Category:metabolite == Metabolite L-methionyl-glycyl-Protein == * common-name: ** an n-terminal-l-methionyl-glycyl-[protein] == Reaction(s) known to consume the compound =...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-methionyl-glycyl-Protein == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-terminal-l-methionyl-glycyl-[protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17875]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-terminal-l-methionyl-glycyl-[protein]}} |
| − | |||
| − | |||
Revision as of 08:27, 15 March 2021
Contents
Metabolite L-methionyl-glycyl-Protein
- common-name:
- an n-terminal-l-methionyl-glycyl-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-terminal-l-methionyl-glycyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
