Difference between revisions of "DATP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ04816 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * ATPASE-RXN ** Category...")
(Created page with "Category:metabolite == Metabolite DATP == * common-name: ** datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o * inchi-k...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ04816 ==
+
== Metabolite DATP ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** datp
== Reaction(s) associated ==
+
* smiles:
* [[ATPASE-RXN]]
+
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** suyvubyjarfzho-rrkcrqdmsa-j
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* molecular-weight:
{{#set: nb reaction associated=1}}
+
** 487.152
 +
== Reaction(s) known to consume the compound ==
 +
* [[DATCY]]
 +
* [[DATPtm]]
 +
* [[DATUP]]
 +
* [[RXN-14195]]
 +
* [[RXN-14214]]
 +
* [[RXN0-384]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[DADPKIN-RXN]]
 +
* [[DATPtm]]
 +
* [[NDPK]]
 +
* [[NDPKm]]
 +
* [[RXN-14192]]
 +
* [[RXN0-745]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=datp}}
 +
{{#set: inchi-key=inchikey=suyvubyjarfzho-rrkcrqdmsa-j}}
 +
{{#set: molecular-weight=487.152}}

Latest revision as of 11:14, 18 March 2021

Metabolite DATP

  • common-name:
    • datp
  • smiles:
    • c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
  • inchi-key:
    • suyvubyjarfzho-rrkcrqdmsa-j
  • molecular-weight:
    • 487.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality