Difference between revisions of "DATP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04816 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * ATPASE-RXN ** Category...") |
(Created page with "Category:metabolite == Metabolite DATP == * common-name: ** datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o * inchi-k...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DATP == |
− | == | + | * common-name: |
− | * [[ | + | ** datp |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o |
− | ** | + | * inchi-key: |
− | ** | + | ** suyvubyjarfzho-rrkcrqdmsa-j |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 487.152 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[DATCY]] | ||
+ | * [[DATPtm]] | ||
+ | * [[DATUP]] | ||
+ | * [[RXN-14195]] | ||
+ | * [[RXN-14214]] | ||
+ | * [[RXN0-384]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[DADPKIN-RXN]] | ||
+ | * [[DATPtm]] | ||
+ | * [[NDPK]] | ||
+ | * [[NDPKm]] | ||
+ | * [[RXN-14192]] | ||
+ | * [[RXN0-745]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=datp}} | ||
+ | {{#set: inchi-key=inchikey=suyvubyjarfzho-rrkcrqdmsa-j}} | ||
+ | {{#set: molecular-weight=487.152}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite DATP
- common-name:
- datp
- smiles:
- c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
- inchi-key:
- suyvubyjarfzho-rrkcrqdmsa-j
- molecular-weight:
- 487.152