Difference between revisions of "DATP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FORMATE == * common-name: ** formate * smiles: ** [ch]([o-])=o * inchi-key: ** bdagihxwwsansr-uhfffaoysa-m * molecular-weight: ** 45.018...")
(Created page with "Category:metabolite == Metabolite DATP == * common-name: ** datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o * inchi-k...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FORMATE ==
+
== Metabolite DATP ==
 
* common-name:
 
* common-name:
** formate
+
** datp
 
* smiles:
 
* smiles:
** [ch]([o-])=o
+
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
 
* inchi-key:
 
* inchi-key:
** bdagihxwwsansr-uhfffaoysa-m
+
** suyvubyjarfzho-rrkcrqdmsa-j
 
* molecular-weight:
 
* molecular-weight:
** 45.018
+
** 487.152
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.2.1.2-RXN]]
+
* [[DATCY]]
* [[FORMATETHFLIG-RXN]]
+
* [[DATPtm]]
* [[FORthi]]
+
* [[DATUP]]
* [[FTHFL]]
+
* [[RXN-14195]]
* [[RXN0-723]]
+
* [[RXN-14214]]
* [[RXN0-724]]
+
* [[RXN0-384]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[DADPKIN-RXN]]
 +
* [[DATPtm]]
 +
* [[NDPK]]
 +
* [[NDPKm]]
 +
* [[RXN-14192]]
 
* [[RXN0-745]]
 
* [[RXN0-745]]
* [[RXN0-746]]
 
== Reaction(s) known to produce the compound ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[1.14.13.70-RXN]]
 
* [[1.2.1.2-RXN]]
 
* [[3.5.1.27-RXN]]
 
* [[3.5.1.88-RXN]]
 
* [[ARYLFORMAMIDASE-RXN]]
 
* [[DIOHBUTANONEPSYN-RXN]]
 
* [[FORMATETHFLIG-RXN]]
 
* [[FORMYLTHFDEFORMYL-RXN]]
 
* [[FORthi]]
 
* [[FTHDF]]
 
* [[GTP-CYCLOHYDRO-I-RXN]]
 
* [[GTP-CYCLOHYDRO-II-RXN]]
 
* [[OXALATE-DECARBOXYLASE-RXN]]
 
* [[PYRIMSYN1-RXN]]
 
* [[R147-RXN]]
 
* [[RXN-11881]]
 
* [[RXN-13707]]
 
* [[RXN-13868]]
 
* [[RXN-13961]]
 
* [[RXN-17150]]
 
* [[RXN3O-130]]
 
* [[RXN66-13]]
 
* [[RXN66-305]]
 
* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=formate}}
+
{{#set: common-name=datp}}
{{#set: inchi-key=inchikey=bdagihxwwsansr-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=suyvubyjarfzho-rrkcrqdmsa-j}}
{{#set: molecular-weight=45.018}}
+
{{#set: molecular-weight=487.152}}

Latest revision as of 11:14, 18 March 2021

Metabolite DATP

  • common-name:
    • datp
  • smiles:
    • c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
  • inchi-key:
    • suyvubyjarfzho-rrkcrqdmsa-j
  • molecular-weight:
    • 487.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality