Difference between revisions of "DATP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-469 == * common-name: ** n-acetyl-l-glutamate 5-semialdehyde * smiles: ** cc(=o)nc(c([o-])=o)cc[ch]=o * inchi-key: ** bcpsfkbphhbdai-...")
(Created page with "Category:metabolite == Metabolite DATP == * common-name: ** datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o * inchi-k...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-469 ==
+
== Metabolite DATP ==
 
* common-name:
 
* common-name:
** n-acetyl-l-glutamate 5-semialdehyde
+
** datp
 
* smiles:
 
* smiles:
** cc(=o)nc(c([o-])=o)cc[ch]=o
+
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
 
* inchi-key:
 
* inchi-key:
** bcpsfkbphhbdai-lurjtmiesa-m
+
** suyvubyjarfzho-rrkcrqdmsa-j
 
* molecular-weight:
 
* molecular-weight:
** 172.16
+
** 487.152
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETYLORNTRANSAM-RXN]]
+
* [[DATCY]]
* [[N-ACETYLGLUTPREDUCT-RXN]]
+
* [[DATPtm]]
 +
* [[DATUP]]
 +
* [[RXN-14195]]
 +
* [[RXN-14214]]
 +
* [[RXN0-384]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETYLORNTRANSAM-RXN]]
+
* [[DADPKIN-RXN]]
* [[N-ACETYLGLUTPREDUCT-RXN]]
+
* [[DATPtm]]
 +
* [[NDPK]]
 +
* [[NDPKm]]
 +
* [[RXN-14192]]
 +
* [[RXN0-745]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-l-glutamate 5-semialdehyde}}
+
{{#set: common-name=datp}}
{{#set: inchi-key=inchikey=bcpsfkbphhbdai-lurjtmiesa-m}}
+
{{#set: inchi-key=inchikey=suyvubyjarfzho-rrkcrqdmsa-j}}
{{#set: molecular-weight=172.16}}
+
{{#set: molecular-weight=487.152}}

Latest revision as of 11:14, 18 March 2021

Metabolite DATP

  • common-name:
    • datp
  • smiles:
    • c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
  • inchi-key:
    • suyvubyjarfzho-rrkcrqdmsa-j
  • molecular-weight:
    • 487.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality