Difference between revisions of "DATP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10869 == * transcription-direction: ** negative * right-end-position: ** 225424 * left-end-position: ** 203752 * centisome-position: ** 53.30975...") |
(Created page with "Category:metabolite == Metabolite DATP == * common-name: ** datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o * inchi-k...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DATP == |
| − | * | + | * common-name: |
| − | ** | + | ** datp |
| − | * | + | * smiles: |
| − | ** | + | ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** suyvubyjarfzho-rrkcrqdmsa-j |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 487.152 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[DATCY]] |
| − | == Reaction(s) | + | * [[DATPtm]] |
| − | * [[ | + | * [[DATUP]] |
| − | ** | + | * [[RXN-14195]] |
| − | ** | + | * [[RXN-14214]] |
| − | {{#set: | + | * [[RXN0-384]] |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | + | * [[DADPKIN-RXN]] | |
| − | {{#set: | + | * [[DATPtm]] |
| − | + | * [[NDPK]] | |
| − | + | * [[NDPKm]] | |
| + | * [[RXN-14192]] | ||
| + | * [[RXN0-745]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=datp}} | ||
| + | {{#set: inchi-key=inchikey=suyvubyjarfzho-rrkcrqdmsa-j}} | ||
| + | {{#set: molecular-weight=487.152}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite DATP
- common-name:
- datp
- smiles:
- c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
- inchi-key:
- suyvubyjarfzho-rrkcrqdmsa-j
- molecular-weight:
- 487.152
