Difference between revisions of "DATP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9895 == * common-name: ** 3,4-dihydroxy-5-all-trans-decaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...")
(Created page with "Category:metabolite == Metabolite CPD-469 == * common-name: ** n-acetyl-l-glutamate 5-semialdehyde * smiles: ** cc(=o)nc(c([o-])=o)cc[ch]=o * inchi-key: ** bcpsfkbphhbdai-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9895 ==
+
== Metabolite CPD-469 ==
 
* common-name:
 
* common-name:
** 3,4-dihydroxy-5-all-trans-decaprenylbenzoate
+
** n-acetyl-l-glutamate 5-semialdehyde
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c)c)c
+
** cc(=o)nc(c([o-])=o)cc[ch]=o
 
* inchi-key:
 
* inchi-key:
** hgwugdiatlopbn-bhzqgfrmsa-m
+
** bcpsfkbphhbdai-lurjtmiesa-m
 
* molecular-weight:
 
* molecular-weight:
** 834.296
+
** 172.16
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9282]]
+
* [[ACETYLORNTRANSAM-RXN]]
 +
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ACETYLORNTRANSAM-RXN]]
 +
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,4-dihydroxy-5-all-trans-decaprenylbenzoate}}
+
{{#set: common-name=n-acetyl-l-glutamate 5-semialdehyde}}
{{#set: inchi-key=inchikey=hgwugdiatlopbn-bhzqgfrmsa-m}}
+
{{#set: inchi-key=inchikey=bcpsfkbphhbdai-lurjtmiesa-m}}
{{#set: molecular-weight=834.296}}
+
{{#set: molecular-weight=172.16}}

Revision as of 15:27, 5 January 2021

Metabolite CPD-469

  • common-name:
    • n-acetyl-l-glutamate 5-semialdehyde
  • smiles:
    • cc(=o)nc(c([o-])=o)cc[ch]=o
  • inchi-key:
    • bcpsfkbphhbdai-lurjtmiesa-m
  • molecular-weight:
    • 172.16

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality