Difference between revisions of "DATP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-469 == * common-name: ** n-acetyl-l-glutamate 5-semialdehyde * smiles: ** cc(=o)nc(c([o-])=o)cc[ch]=o * inchi-key: ** bcpsfkbphhbdai-...")
(Created page with "Category:metabolite == Metabolite CPD-12115 == * common-name: ** demethylmenaquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-469 ==
+
== Metabolite CPD-12115 ==
 
* common-name:
 
* common-name:
** n-acetyl-l-glutamate 5-semialdehyde
+
** demethylmenaquinol-8
 
* smiles:
 
* smiles:
** cc(=o)nc(c([o-])=o)cc[ch]=o
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2))
 
* inchi-key:
 
* inchi-key:
** bcpsfkbphhbdai-lurjtmiesa-m
+
** fgypgicsxjekcg-aendiincsa-n
 
* molecular-weight:
 
* molecular-weight:
** 172.16
+
** 705.118
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETYLORNTRANSAM-RXN]]
+
* [[ADOMET-DMK-METHYLTRANSFER-RXN]]
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETYLORNTRANSAM-RXN]]
 
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-l-glutamate 5-semialdehyde}}
+
{{#set: common-name=demethylmenaquinol-8}}
{{#set: inchi-key=inchikey=bcpsfkbphhbdai-lurjtmiesa-m}}
+
{{#set: inchi-key=inchikey=fgypgicsxjekcg-aendiincsa-n}}
{{#set: molecular-weight=172.16}}
+
{{#set: molecular-weight=705.118}}

Revision as of 13:10, 14 January 2021

Metabolite CPD-12115

  • common-name:
    • demethylmenaquinol-8
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2))
  • inchi-key:
    • fgypgicsxjekcg-aendiincsa-n
  • molecular-weight:
    • 705.118

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality