Difference between revisions of "DATP"

Revision as of 18:55, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-12115 ==
+== Metabolite 2-CARBOXY-D-ARABINITOL ==
 * common-name:
-** demethylmenaquinol-8
+** 2-carboxy-d-arabinitol
 * smiles:
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2))
+** c(c(c(c(c([o-])=o)(co)o)o)o)o
 * inchi-key:
-** fgypgicsxjekcg-aendiincsa-n
+** xondrgralztvkd-zmizwqjlsa-m
 * molecular-weight:
-** 705.118
+** 195.149
 == Reaction(s) known to consume the compound ==
-* [[ADOMET-DMK-METHYLTRANSFER-RXN]]
 == Reaction(s) known to produce the compound ==
+* [[2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=demethylmenaquinol-8}}
+{{#set: common-name=2-carboxy-d-arabinitol}}
-{{#set: inchi-key=inchikey=fgypgicsxjekcg-aendiincsa-n}}
+{{#set: inchi-key=inchikey=xondrgralztvkd-zmizwqjlsa-m}}
-{{#set: molecular-weight=705.118}}
+{{#set: molecular-weight=195.149}}