Difference between revisions of "DCDP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PROTEIN-L-BETA-ISOASPARTATES == * common-name: ** a [protein]-l-β-isoaspartate == Reaction(s) known to consume the compound == * 2...")
(Created page with "Category:metabolite == Metabolite DCDP == * common-name: ** dcdp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o * inchi-key: ** ftdhdkpuhblb...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PROTEIN-L-BETA-ISOASPARTATES ==
+
== Metabolite DCDP ==
 
* common-name:
 
* common-name:
** a [protein]-l-β-isoaspartate
+
** dcdp
 +
* smiles:
 +
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o
 +
* inchi-key:
 +
** ftdhdkpuhblbtl-shyzeuofsa-k
 +
* molecular-weight:
 +
** 384.155
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.77-RXN]]
+
* [[ATDCD]]
 +
* [[ATDCDm]]
 +
* [[DCDPKIN-RXN]]
 +
* [[DCTPtm]]
 +
* [[RXN-14187]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ATDCM]]
 +
* [[CDPREDUCT-RXN]]
 +
* [[DCDT]]
 +
* [[DCTCP]]
 +
* [[DCTPtm]]
 +
* [[DCTUP]]
 +
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
 +
* [[RXN-14216]]
 +
* [[RXN-7913]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein]-l-β-isoaspartate}}
+
{{#set: common-name=dcdp}}
 +
{{#set: inchi-key=inchikey=ftdhdkpuhblbtl-shyzeuofsa-k}}
 +
{{#set: molecular-weight=384.155}}

Latest revision as of 11:12, 18 March 2021

Metabolite DCDP

  • common-name:
    • dcdp
  • smiles:
    • c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o
  • inchi-key:
    • ftdhdkpuhblbtl-shyzeuofsa-k
  • molecular-weight:
    • 384.155

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality