Difference between revisions of "DCDP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16475 == * transcription-direction: ** positive * right-end-position: ** 49104 * left-end-position: ** 40372 * centisome-position: ** 14.320985...")
(Created page with "Category:metabolite == Metabolite DCDP == * common-name: ** dcdp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o * inchi-key: ** ftdhdkpuhblb...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ16475 ==
+
== Metabolite DCDP ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** dcdp
−
* right-end-position:
+
* smiles:
−
** 49104
+
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 40372
+
** ftdhdkpuhblbtl-shyzeuofsa-k
−
* centisome-position:
+
* molecular-weight:
−
** 14.320985   
+
** 384.155
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ATDCD]]
−
== Reaction(s) associated ==
+
* [[ATDCDm]]
−
* [[1.1.1.8-RXN]]
+
* [[DCDPKIN-RXN]]
−
** Category: [[annotation]]
+
* [[DCTPtm]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14187]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[ATDCM]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[CDPREDUCT-RXN]]
−
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
+
* [[DCDT]]
−
** Category: [[annotation]]
+
* [[DCTCP]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DCTPtm]]
−
** Category: [[orthology]]
+
* [[DCTUP]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
−
== Pathway(s) associated ==
+
* [[RXN-14216]]
−
* [[PWY-6118]]
+
* [[RXN-7913]]
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-7385]]
+
{{#set: common-name=dcdp}}
−
** '''7''' reactions found over '''9''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=ftdhdkpuhblbtl-shyzeuofsa-k}}
−
* [[PWY-7411]]
+
{{#set: molecular-weight=384.155}}
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-7902]]
 
−
** '''2''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-5981]]
 
−
** '''3''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY0-1319]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5667]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=49104}}
 
−
{{#set: left-end-position=40372}}
 
−
{{#set: centisome-position=14.320985    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=7}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite DCDP

  • common-name:
    • dcdp
  • smiles:
    • c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o
  • inchi-key:
    • ftdhdkpuhblbtl-shyzeuofsa-k
  • molecular-weight:
    • 384.155

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DCDP&oldid=137502"