Difference between revisions of "DCDP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Sulfurated-Sulfur-Acceptors == * common-name: ** a sulfurated [sulfur carrier] == Reaction(s) known to consume the compound == * 2.8.1....") |
(Created page with "Category:metabolite == Metabolite DCDP == * common-name: ** dcdp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o * inchi-key: ** ftdhdkpuhblb...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DCDP == |
* common-name: | * common-name: | ||
− | ** | + | ** dcdp |
+ | * smiles: | ||
+ | ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o | ||
+ | * inchi-key: | ||
+ | ** ftdhdkpuhblbtl-shyzeuofsa-k | ||
+ | * molecular-weight: | ||
+ | ** 384.155 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ATDCD]] |
− | * [[ | + | * [[ATDCDm]] |
− | + | * [[DCDPKIN-RXN]] | |
− | * [[ | + | * [[DCTPtm]] |
− | + | * [[RXN-14187]] | |
− | * [[ | ||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[ATDCM]] |
− | * [[RXN- | + | * [[CDPREDUCT-RXN]] |
+ | * [[DCDT]] | ||
+ | * [[DCTCP]] | ||
+ | * [[DCTPtm]] | ||
+ | * [[DCTUP]] | ||
+ | * [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]] | ||
+ | * [[RXN-14216]] | ||
+ | * [[RXN-7913]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dcdp}} |
+ | {{#set: inchi-key=inchikey=ftdhdkpuhblbtl-shyzeuofsa-k}} | ||
+ | {{#set: molecular-weight=384.155}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite DCDP
- common-name:
- dcdp
- smiles:
- c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o
- inchi-key:
- ftdhdkpuhblbtl-shyzeuofsa-k
- molecular-weight:
- 384.155