Difference between revisions of "DCDP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07884 == * transcription-direction: ** negative * right-end-position: ** 79933 * left-end-position: ** 78308 * centisome-position: ** 97.67744...")
 
(Created page with "Category:metabolite == Metabolite DCDP == * common-name: ** dcdp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o * inchi-key: ** ftdhdkpuhblb...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ07884 ==
+
== Metabolite DCDP ==
* transcription-direction:
+
* common-name:
** negative
+
** dcdp
* right-end-position:
+
* smiles:
** 79933
+
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o
* left-end-position:
+
* inchi-key:
** 78308
+
** ftdhdkpuhblbtl-shyzeuofsa-k
* centisome-position:
+
* molecular-weight:
** 97.67744   
+
** 384.155
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[ATDCD]]
== Reaction(s) associated ==
+
* [[ATDCDm]]
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
* [[DCDPKIN-RXN]]
** Category: [[annotation]]
+
* [[DCTPtm]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14187]]
{{#set: transcription-direction=negative}}
+
== Reaction(s) known to produce the compound ==
{{#set: right-end-position=79933}}
+
* [[ATDCM]]
{{#set: left-end-position=78308}}
+
* [[CDPREDUCT-RXN]]
{{#set: centisome-position=97.67744    }}
+
* [[DCDT]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[DCTCP]]
{{#set: nb reaction associated=1}}
+
* [[DCTPtm]]
 +
* [[DCTUP]]
 +
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
 +
* [[RXN-14216]]
 +
* [[RXN-7913]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=dcdp}}
 +
{{#set: inchi-key=inchikey=ftdhdkpuhblbtl-shyzeuofsa-k}}
 +
{{#set: molecular-weight=384.155}}

Latest revision as of 11:12, 18 March 2021

Metabolite DCDP

  • common-name:
    • dcdp
  • smiles:
    • c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o
  • inchi-key:
    • ftdhdkpuhblbtl-shyzeuofsa-k
  • molecular-weight:
    • 384.155

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality