Difference between revisions of "DCMP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-GULONATE == * common-name: ** l-gulonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-qtbdoelssa-m * molec...") |
(Created page with "Category:metabolite == Metabolite 4-METHYLCATECHOL == * common-name: ** 4-methylcatechol * smiles: ** cc1(c=cc(o)=c(c=1)o) * inchi-key: ** zbcatmyqydctiz-uhfffaoysa-n * mo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 4-METHYLCATECHOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-methylcatechol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(c=cc(o)=c(c=1)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zbcatmyqydctiz-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 124.139 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10078]] |
| − | * [[RXN- | + | * [[RXN-10079]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-methylcatechol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zbcatmyqydctiz-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=124.139}} |
Revision as of 11:17, 15 January 2021
Contents
Metabolite 4-METHYLCATECHOL
- common-name:
- 4-methylcatechol
- smiles:
- cc1(c=cc(o)=c(c=1)o)
- inchi-key:
- zbcatmyqydctiz-uhfffaoysa-n
- molecular-weight:
- 124.139
