Difference between revisions of "DCMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ECOAH7h ECOAH7h] == * direction: ** reversible * common-name: ** enoyl-coa hydratase (c16:0) == Rea...")
(Created page with "Category:metabolite == Metabolite DCMP == * common-name: ** dcmp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o * inchi-key: ** ncmvoabpesmrcp-shyzeuofs...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ECOAH7h ECOAH7h] ==
+
== Metabolite DCMP ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** enoyl-coa hydratase (c16:0)
+
** dcmp
== Reaction formula ==
+
* smiles:
* 1.0 [[CPD0-2232]][h] '''<=>''' 1.0 [[CPD0-2117]][h] '''+''' 1.0 [[WATER]][h]
+
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ03584]]
+
** ncmvoabpesmrcp-shyzeuofsa-l
** Category: [[orthology]]
+
* molecular-weight:
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 305.183
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
== Reconstruction information  ==
+
* [[ATDCM]]
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[DCMP-DEAMINASE-RXN]]
== External links  ==
+
* [[RXN-7913]]
{{#set: direction=reversible}}
+
== Reaction(s) known to produce the compound ==
{{#set: common-name=enoyl-coa hydratase (c16:0)}}
+
* [[DCTP-PYROPHOSPHATASE-RXN]]
{{#set: nb gene associated=1}}
+
* [[RXN-14187]]
{{#set: nb pathway associated=0}}
+
* [[RXN-14198]]
{{#set: reconstruction category=orthology}}
+
== Reaction(s) of unknown directionality ==
{{#set: reconstruction tool=pantograph}}
+
{{#set: common-name=dcmp}}
{{#set: reconstruction comment=n.a}}
+
{{#set: inchi-key=inchikey=ncmvoabpesmrcp-shyzeuofsa-l}}
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
+
{{#set: molecular-weight=305.183}}

Latest revision as of 11:15, 18 March 2021

Metabolite DCMP

  • common-name:
    • dcmp
  • smiles:
    • c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o
  • inchi-key:
    • ncmvoabpesmrcp-shyzeuofsa-l
  • molecular-weight:
    • 305.183

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality