Difference between revisions of "DCMP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ06001 == * transcription-direction: ** positive * right-end-position: ** 234461 * left-end-position: ** 206764 * centisome-position: ** 42.809345...") |
(Created page with "Category:metabolite == Metabolite DCMP == * common-name: ** dcmp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o * inchi-key: ** ncmvoabpesmrcp-shyzeuofs...") |
||
| (7 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DCMP == |
| − | * | + | * common-name: |
| − | ** | + | ** dcmp |
| − | * | + | * smiles: |
| − | ** | + | ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** ncmvoabpesmrcp-shyzeuofsa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 305.183 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[ATDCM]] |
| − | + | * [[DCMP-DEAMINASE-RXN]] | |
| − | * [[ | + | * [[RXN-7913]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[DCTP-PYROPHOSPHATASE-RXN]] | |
| − | * [[ | + | * [[RXN-14187]] |
| − | * | + | * [[RXN-14198]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=dcmp}} | |
| − | + | {{#set: inchi-key=inchikey=ncmvoabpesmrcp-shyzeuofsa-l}} | |
| − | + | {{#set: molecular-weight=305.183}} | |
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DCMP
- common-name:
- dcmp
- smiles:
- c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o
- inchi-key:
- ncmvoabpesmrcp-shyzeuofsa-l
- molecular-weight:
- 305.183
