Difference between revisions of "DCTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8775 == * common-name: ** m-toluate * smiles: ** cc1(=cc(=cc=c1)c(=o)[o-]) * inchi-key: ** gpsduzxpycfosq-uhfffaoysa-m * molecular-we...")
(Created page with "Category:metabolite == Metabolite DCTP == * common-name: ** dctp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8775 ==
+
== Metabolite DCTP ==
 
* common-name:
 
* common-name:
** m-toluate
+
** dctp
 
* smiles:
 
* smiles:
** cc1(=cc(=cc=c1)c(=o)[o-])
+
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
 
* inchi-key:
 
* inchi-key:
** gpsduzxpycfosq-uhfffaoysa-m
+
** rgwhqcvhvjxokc-shyzeuofsa-j
 
* molecular-weight:
 
* molecular-weight:
** 135.142
+
** 463.127
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[DCTCP]]
 +
* [[DCTP-PYROPHOSPHATASE-RXN]]
 +
* [[DCTPtm]]
 +
* [[DCTUP]]
 +
* [[RXN-14198]]
 +
* [[RXN-14216]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8583]]
+
* [[ATDCD]]
 +
* [[ATDCDm]]
 +
* [[DCDPKIN-RXN]]
 +
* [[DCTPtm]]
 +
* [[RXN0-723]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=m-toluate}}
+
{{#set: common-name=dctp}}
{{#set: inchi-key=inchikey=gpsduzxpycfosq-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=rgwhqcvhvjxokc-shyzeuofsa-j}}
{{#set: molecular-weight=135.142}}
+
{{#set: molecular-weight=463.127}}

Latest revision as of 11:15, 18 March 2021

Metabolite DCTP

  • common-name:
    • dctp
  • smiles:
    • c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
  • inchi-key:
    • rgwhqcvhvjxokc-shyzeuofsa-j
  • molecular-weight:
    • 463.127

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality