Difference between revisions of "DCTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9543 RXN-9543] == * direction: ** left-to-right * common-name: ** 3-oxo-stearoyl-coa synthase *...")
(Created page with "Category:metabolite == Metabolite DCTP == * common-name: ** dctp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9543 RXN-9543] ==
+
== Metabolite DCTP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 3-oxo-stearoyl-coa synthase
+
** dctp
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.1.199 ec-2.3.1.199]
+
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[MALONYL-COA]][c] '''+''' 1 [[PALMITYL-COA]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CPD-10260]][c]
+
** rgwhqcvhvjxokc-shyzeuofsa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ00613]]
+
** 463.127
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[DCTCP]]
−
** Category: [[orthology]]
+
* [[DCTP-PYROPHOSPHATASE-RXN]]
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[DCTPtm]]
−
* Gene: [[SJ11672]]
+
* [[DCTUP]]
−
** Category: [[annotation]]
+
* [[RXN-14198]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-14216]]
−
* Gene: [[SJ19629]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[ATDCD]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ATDCDm]]
−
* Gene: [[SJ06616]]
+
* [[DCDPKIN-RXN]]
−
** Category: [[annotation]]
+
* [[DCTPtm]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN0-723]]
−
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-5972]], stearate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5972 PWY-5972]
+
{{#set: common-name=dctp}}
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=rgwhqcvhvjxokc-shyzeuofsa-j}}
−
== Reconstruction information  ==
+
{{#set: molecular-weight=463.127}}
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07758 R07758]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=3-oxo-stearoyl-coa synthase}}
 
−
{{#set: ec-number=ec-2.3.1.199}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite DCTP

  • common-name:
    • dctp
  • smiles:
    • c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
  • inchi-key:
    • rgwhqcvhvjxokc-shyzeuofsa-j
  • molecular-weight:
    • 463.127

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DCTP&oldid=138808"