Difference between revisions of "DCTP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FLAVANONES == * common-name: ** a flavanone == Reaction(s) known to consume the compound == * CHALCONE-ISOMERASE-RXN == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite DCTP == * common-name: ** dctp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DCTP == |
* common-name: | * common-name: | ||
| − | ** | + | ** dctp |
| + | * smiles: | ||
| + | ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o | ||
| + | * inchi-key: | ||
| + | ** rgwhqcvhvjxokc-shyzeuofsa-j | ||
| + | * molecular-weight: | ||
| + | ** 463.127 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DCTCP]] |
| + | * [[DCTP-PYROPHOSPHATASE-RXN]] | ||
| + | * [[DCTPtm]] | ||
| + | * [[DCTUP]] | ||
| + | * [[RXN-14198]] | ||
| + | * [[RXN-14216]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ATDCD]] |
| + | * [[ATDCDm]] | ||
| + | * [[DCDPKIN-RXN]] | ||
| + | * [[DCTPtm]] | ||
| + | * [[RXN0-723]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dctp}} |
| + | {{#set: inchi-key=inchikey=rgwhqcvhvjxokc-shyzeuofsa-j}} | ||
| + | {{#set: molecular-weight=463.127}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DCTP
- common-name:
- dctp
- smiles:
- c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
- inchi-key:
- rgwhqcvhvjxokc-shyzeuofsa-j
- molecular-weight:
- 463.127
