Difference between revisions of "DCTP"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.14.10-RXN 3.4.14.10-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy...") |
(Created page with "Category:metabolite == Metabolite DCTP == * common-name: ** dctp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DCTP == |
| − | * | + | * common-name: |
| − | ** | + | ** dctp |
| − | * | + | * smiles: |
| − | ** | + | ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o |
| − | == Reaction | + | * inchi-key: |
| − | * | + | ** rgwhqcvhvjxokc-shyzeuofsa-j |
| − | + | * molecular-weight: | |
| − | * | + | ** 463.127 |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[DCTCP]] |
| − | == | + | * [[DCTP-PYROPHOSPHATASE-RXN]] |
| − | + | * [[DCTPtm]] | |
| − | * | + | * [[DCTUP]] |
| − | + | * [[RXN-14198]] | |
| − | * | + | * [[RXN-14216]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[ATDCD]] | |
| − | + | * [[ATDCDm]] | |
| − | + | * [[DCDPKIN-RXN]] | |
| − | + | * [[DCTPtm]] | |
| − | + | * [[RXN0-723]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=dctp}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=rgwhqcvhvjxokc-shyzeuofsa-j}} |
| − | + | {{#set: molecular-weight=463.127}} | |
| − | {{#set: | ||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DCTP
- common-name:
- dctp
- smiles:
- c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
- inchi-key:
- rgwhqcvhvjxokc-shyzeuofsa-j
- molecular-weight:
- 463.127
