Difference between revisions of "DEAMIDO-NAD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ15538 == * transcription-direction: ** positive * right-end-position: ** 254671 * left-end-position: ** 252731 * centisome-position: ** 85.9603...")
 
(Created page with "Category:metabolite == Metabolite DEAMIDO-NAD == * common-name: ** nicotinate adenine dinucleotide * smiles: ** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ15538 ==
+
== Metabolite DEAMIDO-NAD ==
* transcription-direction:
+
* common-name:
** positive
+
** nicotinate adenine dinucleotide
* right-end-position:
+
* smiles:
** 254671
+
** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
* left-end-position:
+
* inchi-key:
** 252731
+
** senpvezbrzqvst-hisdbwnosa-l
* centisome-position:
+
* molecular-weight:
** 85.9603   
+
** 662.399
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[NAD-SYNTH-GLN-RXN]]
== Reaction(s) associated ==
+
* [[NAD-SYNTH-NH3-RXN]]
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[NICONUCADENYLYLTRAN-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
{{#set: transcription-direction=positive}}
+
{{#set: common-name=nicotinate adenine dinucleotide}}
{{#set: right-end-position=254671}}
+
{{#set: inchi-key=inchikey=senpvezbrzqvst-hisdbwnosa-l}}
{{#set: left-end-position=252731}}
+
{{#set: molecular-weight=662.399}}
{{#set: centisome-position=85.9603    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite DEAMIDO-NAD

  • common-name:
    • nicotinate adenine dinucleotide
  • smiles:
    • c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
  • inchi-key:
    • senpvezbrzqvst-hisdbwnosa-l
  • molecular-weight:
    • 662.399

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality