Difference between revisions of "DEAMIDO-NAD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15838 == * common-name: ** γ-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c * inchi-key: *...")
(Created page with "Category:metabolite == Metabolite DEAMIDO-NAD == * common-name: ** nicotinate adenine dinucleotide * smiles: ** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15838 ==
+
== Metabolite DEAMIDO-NAD ==
 
* common-name:
 
* common-name:
** γ-tocotrienol
+
** nicotinate adenine dinucleotide
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c
+
** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
 
* inchi-key:
 
* inchi-key:
** otxntmvvoobzcv-wazjvijmsa-n
+
** senpvezbrzqvst-hisdbwnosa-l
 
* molecular-weight:
 
* molecular-weight:
** 410.639
+
** 662.399
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14918]]
+
* [[NAD-SYNTH-GLN-RXN]]
 +
* [[NAD-SYNTH-NH3-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[NICONUCADENYLYLTRAN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-tocotrienol}}
+
{{#set: common-name=nicotinate adenine dinucleotide}}
{{#set: inchi-key=inchikey=otxntmvvoobzcv-wazjvijmsa-n}}
+
{{#set: inchi-key=inchikey=senpvezbrzqvst-hisdbwnosa-l}}
{{#set: molecular-weight=410.639}}
+
{{#set: molecular-weight=662.399}}

Latest revision as of 11:13, 18 March 2021

Metabolite DEAMIDO-NAD

  • common-name:
    • nicotinate adenine dinucleotide
  • smiles:
    • c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
  • inchi-key:
    • senpvezbrzqvst-hisdbwnosa-l
  • molecular-weight:
    • 662.399

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality