Difference between revisions of "DEAMIDO-NAD"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ15634 == * transcription-direction: ** positive * right-end-position: ** 267464 * left-end-position: ** 262381 * centisome-position: ** 89.508286...") |
(Created page with "Category:metabolite == Metabolite DEAMIDO-NAD == * common-name: ** nicotinate adenine dinucleotide * smiles: ** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DEAMIDO-NAD == |
− | * | + | * common-name: |
− | ** | + | ** nicotinate adenine dinucleotide |
− | * | + | * smiles: |
− | ** | + | ** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o) |
− | + | * inchi-key: | |
− | + | ** senpvezbrzqvst-hisdbwnosa-l | |
− | + | * molecular-weight: | |
− | + | ** 662.399 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[NAD-SYNTH-GLN-RXN]] | |
− | == | + | * [[NAD-SYNTH-NH3-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[NICONUCADENYLYLTRAN-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=nicotinate adenine dinucleotide}} | |
− | * | + | {{#set: inchi-key=inchikey=senpvezbrzqvst-hisdbwnosa-l}} |
− | ** | + | {{#set: molecular-weight=662.399}} |
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:32, 18 December 2020
Contents
Metabolite DEAMIDO-NAD
- common-name:
- nicotinate adenine dinucleotide
- smiles:
- c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
- inchi-key:
- senpvezbrzqvst-hisdbwnosa-l
- molecular-weight:
- 662.399