|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.5.1.20-RXN 1.5.1.20-RXN] == | + | == Metabolite SHIKIMATE-5P == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** 5,10-methylenetetrahydrofolate reductase | + | ** shikimate 3-phosphate |
| − | ** methylenetetrahydrofolate reductase (nad(p)h)
| + | * smiles: |
| − | * ec-number: | + | ** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1) |
| − | ** [http://enzyme.expasy.org/EC/1.5.1.20 ec-1.5.1.20] | + | * inchi-key: |
| − | == Reaction formula == | + | ** qyojskgcwnakgw-pbxrrbtrsa-k |
| − | * 1 [[METHYLENE-THF-GLU-N]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[5-METHYL-THF-GLU-N]][c] '''+''' 1 [[NAD]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction ==
| + | ** 251.109 |
| − | * Gene: [[SJ19532]] | + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]]
| + | * [[2.5.1.19-RXN]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | * [[SHIKIMATE-KINASE-RXN]] |
| − | * Gene: [[SJ09591]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]]
| + | * [[2.5.1.19-RXN]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[SHIKIMATE-KINASE-RXN]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=shikimate 3-phosphate}} |
| − | * Gene: [[SJ00407]]
| + | {{#set: inchi-key=inchikey=qyojskgcwnakgw-pbxrrbtrsa-k}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=251.109}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | * [[1CMET2-PWY]], N10-formyl-tetrahydrofolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=1CMET2-PWY 1CMET2-PWY] | |
| − | ** '''8''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-3841]], folate transformations II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3841 PWY-3841] | |
| − | ** '''9''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[PWY-2201]], folate transformations I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2201 PWY-2201]
| |
| − | ** '''9''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[CODH-PWY]], reductive acetyl coenzyme A pathway I (homoacetogenic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=CODH-PWY CODH-PWY]
| |
| − | ** '''4''' reactions found over '''9''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links ==
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R07168 R07168]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PN93 Q9PN93]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JUT7 Q9JUT7]
| |
| − | ** [http://www.uniprot.org/uniprot/P45208 P45208]
| |
| − | ** [http://www.uniprot.org/uniprot/P0AEZ1 P0AEZ1]
| |
| − | ** [http://www.uniprot.org/uniprot/P11003 P11003]
| |
| − | ** [http://www.uniprot.org/uniprot/P46151 P46151]
| |
| − | ** [http://www.uniprot.org/uniprot/P53128 P53128]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=5,10-methylenetetrahydrofolate reductase|methylenetetrahydrofolate reductase (nad(p)h)}} | |
| − | {{#set: ec-number=ec-1.5.1.20}} | |
| − | {{#set: nb gene associated=3}} | |
| − | {{#set: nb pathway associated=4}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
